C15H25NO7S — CID 142436708
(2S)-2-acetamido-3-[(1S)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanyl-3-methylbutanoic acid (PubChem CID 142436708) has the molecular formula C15H25NO7S and a molecular weight of 363.43 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(1S)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-acetamido-3-[(1S)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 142436708 |
| Molecular Formula | C15H25NO7S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (2S)-2-acetamido-3-[(1S)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylsulfanyl-3-methylbutanoic acid |
| SMILES | CC(=O)N[C@@H](C(=O)O)C(C)(C)SC(=O)O[C@@H](C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H25NO7S/c1-8(17)16-10(11(18)19)15(6,7)24-13(21)23-9(2)22-12(20)14(3,4)5/h9-10H,1-7H3,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | OHARDHABBHZSAL-UWVGGRQHSA-N |
| XLogP | 2.16 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|