About 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid
2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid (PubChem CID 123712094) has the molecular formula C9H16O4S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid |
| PubChem CID | 123712094 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid |
| SMILES | CSCC(OC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H16O4S/c1-9(2,3)8(12)13-6(5-14-4)7(10)11/h6H,5H2,1-4H3,(H,10,11) |
| InChIKey | UIEVSLNTALQLKT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid?
The IUPAC name of 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid (CID 123712094) is 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid is CSCC(OC(=O)C(C)(C)C)C(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid?
The InChIKey is UIEVSLNTALQLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4S/c1-9(2,3)8(12)13-6(5-14-4)7(10)11/h6H,5H2,1-4H3,(H,10,11).
What are the key properties of 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid?
2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid has a molecular weight of 220.29 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoyloxy)-3-methylsulfanylpropanoic acid is sourced from PubChem (CID 123712094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).