C8H14O4S2 — CID 87497387
(2R)-2-[(2S)-2-methyl-3-oxo-3-sulfanylpropoxy]-3-methylsulfanylpropanoic acid (PubChem CID 87497387) has the molecular formula C8H14O4S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-methyl-3-oxo-3-sulfanylpropoxy]-3-methylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2S)-2-methyl-3-oxo-3-sulfanylpropoxy]-3-methylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 87497387 |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (2R)-2-[(2S)-2-methyl-3-oxo-3-sulfanylpropoxy]-3-methylsulfanylpropanoic acid |
| SMILES | CSC[C@H](OC[C@H](C)C(=O)S)C(=O)O |
| InChI | InChI=1S/C8H14O4S2/c1-5(8(11)13)3-12-6(4-14-2)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,13)/t5-,6-/m0/s1 |
| InChIKey | BKZZFDPBHWJQKC-WDSKDSINSA-N |
| XLogP | 0.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|