C10H14O9S — CID 87816473
2-(1-carboxy-2-methylsulfanylethoxy)carbonyl-2-hydroxypentanedioic acid (PubChem CID 87816473) has the molecular formula C10H14O9S and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-(1-carboxy-2-methylsulfanylethoxy)carbonyl-2-hydroxypentanedioic acid.
| Compound Name | 2-(1-carboxy-2-methylsulfanylethoxy)carbonyl-2-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 87816473 |
| Molecular Formula | C10H14O9S |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(1-carboxy-2-methylsulfanylethoxy)carbonyl-2-hydroxypentanedioic acid |
| SMILES | CSCC(OC(=O)C(O)(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O9S/c1-20-4-5(7(13)14)19-9(17)10(18,8(15)16)3-2-6(11)12/h5,18H,2-4H2,1H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | BAHIQDHVLUKMHM-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|