C14H22O9S — CID 87816185
2-(3-butylsulfanyl-1-carboxypropoxy)carbonyl-2-hydroxypentanedioic acid (PubChem CID 87816185) has the molecular formula C14H22O9S and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-(3-butylsulfanyl-1-carboxypropoxy)carbonyl-2-hydroxypentanedioic acid.
| Compound Name | 2-(3-butylsulfanyl-1-carboxypropoxy)carbonyl-2-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 87816185 |
| Molecular Formula | C14H22O9S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-(3-butylsulfanyl-1-carboxypropoxy)carbonyl-2-hydroxypentanedioic acid |
| SMILES | CCCCSCCC(OC(=O)C(O)(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22O9S/c1-2-3-7-24-8-5-9(11(17)18)23-13(21)14(22,12(19)20)6-4-10(15)16/h9,22H,2-8H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | MUZQUDLFCDLRHJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|