C12H18O9S — CID 87754660
2-(1-carboxy-3-ethylsulfanylpropoxy)carbonyl-2-hydroxy-3-methylbutanedioic acid (PubChem CID 87754660) has the molecular formula C12H18O9S and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-(1-carboxy-3-ethylsulfanylpropoxy)carbonyl-2-hydroxy-3-methylbutanedioic acid.
| Compound Name | 2-(1-carboxy-3-ethylsulfanylpropoxy)carbonyl-2-hydroxy-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 87754660 |
| Molecular Formula | C12H18O9S |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-(1-carboxy-3-ethylsulfanylpropoxy)carbonyl-2-hydroxy-3-methylbutanedioic acid |
| SMILES | CCSCCC(OC(=O)C(O)(C(=O)O)C(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18O9S/c1-3-22-5-4-7(9(15)16)21-11(19)12(20,10(17)18)6(2)8(13)14/h6-7,20H,3-5H2,1-2H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | UDTZNEOIRBKJGW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|