C14H24O11 — CID 162495800
2-hydroxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]pentanedioic acid (PubChem CID 162495800) has the molecular formula C14H24O11 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-hydroxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]pentanedioic acid.
| Compound Name | 2-hydroxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]pentanedioic acid |
|---|---|
| PubChem CID | 162495800 |
| Molecular Formula | C14H24O11 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-hydroxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]pentanedioic acid |
| SMILES | O=C(O)CCC(O)(C(=O)O)C(=O)OCCOCCOCCOCCO |
| InChI | InChI=1S/C14H24O11/c15-3-4-22-5-6-23-7-8-24-9-10-25-13(20)14(21,12(18)19)2-1-11(16)17/h15,21H,1-10H2,(H,16,17)(H,18,19) |
| InChIKey | BFNNZZMACPURNX-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|