C10H16O9 — CID 126492957
2-(2-hydroxyethoxy)ethyl 3-formyloxy-2-(formyloxymethyl)-2-hydroxypropanoate (PubChem CID 126492957) has the molecular formula C10H16O9 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 3-formyloxy-2-(formyloxymethyl)-2-hydroxypropanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 3-formyloxy-2-(formyloxymethyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 126492957 |
| Molecular Formula | C10H16O9 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 3-formyloxy-2-(formyloxymethyl)-2-hydroxypropanoate |
| SMILES | O=COCC(O)(COC=O)C(=O)OCCOCCO |
| InChI | InChI=1S/C10H16O9/c11-1-2-16-3-4-19-9(14)10(15,5-17-7-12)6-18-8-13/h7-8,11,15H,1-6H2 |
| InChIKey | RYEMASJYYKRLRP-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|