C7H9F3O5 — CID 88878514
3-[2-(2,2,2-trifluoroacetyl)oxyethoxy]propanoic acid (PubChem CID 88878514) has the molecular formula C7H9F3O5 and a molecular weight of 230.14 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroacetyl)oxyethoxy]propanoic acid.
| Compound Name | 3-[2-(2,2,2-trifluoroacetyl)oxyethoxy]propanoic acid |
|---|---|
| PubChem CID | 88878514 |
| Molecular Formula | C7H9F3O5 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroacetyl)oxyethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O5/c8-7(9,10)6(13)15-4-3-14-2-1-5(11)12/h1-4H2,(H,11,12) |
| InChIKey | MEUOTCCXKWDALG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|