C8H14O12S2 — CID 88719259
4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-3,3-disulfobutanoic acid (PubChem CID 88719259) has the molecular formula C8H14O12S2 and a molecular weight of 366.32 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-3,3-disulfobutanoic acid.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-3,3-disulfobutanoic acid |
|---|---|
| PubChem CID | 88719259 |
| Molecular Formula | C8H14O12S2 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-3,3-disulfobutanoic acid |
| SMILES | O=C(O)CC(C(=O)OCCOCCO)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H14O12S2/c9-1-2-19-3-4-20-7(12)8(5-6(10)11,21(13,14)15)22(16,17)18/h9H,1-5H2,(H,10,11)(H,13,14,15)(H,16,17,18) |
| InChIKey | RCKLXMGFGYUHSJ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|