C8H14O9S — CID 88833180
4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-2-sulfobutanoic acid (PubChem CID 88833180) has the molecular formula C8H14O9S and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-2-sulfobutanoic acid.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-2-sulfobutanoic acid |
|---|---|
| PubChem CID | 88833180 |
| Molecular Formula | C8H14O9S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]-4-oxo-2-sulfobutanoic acid |
| SMILES | O=C(CC(C(=O)O)S(=O)(=O)O)OCCOCCO |
| InChI | InChI=1S/C8H14O9S/c9-1-2-16-3-4-17-7(10)5-6(8(11)12)18(13,14)15/h6,9H,1-5H2,(H,11,12)(H,13,14,15) |
| InChIKey | SNQOJCJIMCYDFD-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|