C11H16O9S — CID 87815733
2-[2-(1-carboxy-2-ethylsulfanylethoxy)acetyl]-2-hydroxybutanedioic acid (PubChem CID 87815733) has the molecular formula C11H16O9S and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-[2-(1-carboxy-2-ethylsulfanylethoxy)acetyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(1-carboxy-2-ethylsulfanylethoxy)acetyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87815733 |
| Molecular Formula | C11H16O9S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[2-(1-carboxy-2-ethylsulfanylethoxy)acetyl]-2-hydroxybutanedioic acid |
| SMILES | CCSCC(OCC(=O)C(O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O9S/c1-2-21-5-6(9(15)16)20-4-7(12)11(19,10(17)18)3-8(13)14/h6,19H,2-5H2,1H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | GXEBLMVDKORCQQ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|