C15H24O8 — CID 146161185
2,3-bis(2,2-dimethylpropanoyloxy)-4-methoxy-4-oxobutanoic acid (PubChem CID 146161185) has the molecular formula C15H24O8 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,3-bis(2,2-dimethylpropanoyloxy)-4-methoxy-4-oxobutanoic acid.
| Compound Name | 2,3-bis(2,2-dimethylpropanoyloxy)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146161185 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2,3-bis(2,2-dimethylpropanoyloxy)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H24O8/c1-14(2,3)12(19)22-8(10(16)17)9(11(18)21-7)23-13(20)15(4,5)6/h8-9H,1-7H3,(H,16,17) |
| InChIKey | ZDUJFXRKOOZITB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|