C18H32O7 — CID 102282445
[(1R,2S)-1-(2,2-dimethylpropanoyloxy)-3-methoxy-1-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl] 2,2-dimethylpropanoate (PubChem CID 102282445) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(1R,2S)-1-(2,2-dimethylpropanoyloxy)-3-methoxy-1-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S)-1-(2,2-dimethylpropanoyloxy)-3-methoxy-1-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102282445 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [(1R,2S)-1-(2,2-dimethylpropanoyloxy)-3-methoxy-1-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl] 2,2-dimethylpropanoate |
| SMILES | COC(=O)[C@@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C18H32O7/c1-16(2,3)14(20)23-11(12(19)22-10)13(25-18(7,8)9)24-15(21)17(4,5)6/h11,13H,1-10H3/t11-,13+/m1/s1 |
| InChIKey | WPKIQMIWNLLCIB-YPMHNXCESA-N |
| XLogP | 2.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|