C9H20N2O4 — CID 58674394
methyl (2S)-2-amino-3-[[(R)-hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]propanoate (PubChem CID 58674394) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[[(R)-hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[[(R)-hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]propanoate |
|---|---|
| PubChem CID | 58674394 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | methyl (2S)-2-amino-3-[[(R)-hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](N)CN[C@H](O)OC(C)(C)C |
| InChI | InChI=1S/C9H20N2O4/c1-9(2,3)15-8(13)11-5-6(10)7(12)14-4/h6,8,11,13H,5,10H2,1-4H3/t6-,8+/m0/s1 |
| InChIKey | WKMYXOIRKRMGAN-POYBYMJQSA-N |
| XLogP | -0.83 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|