C11H23NO4 — CID 126571794
4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2,2-dimethylbutanoic acid (PubChem CID 126571794) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 126571794 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(C)OC(O)NCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H23NO4/c1-10(2,3)16-9(15)12-7-6-11(4,5)8(13)14/h9,12,15H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | ZWOJKSQCCFEBLI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|