C9H18ClNO3 — CID 105481491
methyl 2-amino-5,5-dimethyl-4-oxohexanoate;hydrochloride (PubChem CID 105481491) has the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. Its IUPAC name is methyl 2-amino-5,5-dimethyl-4-oxohexanoate;hydrochloride.
| Compound Name | methyl 2-amino-5,5-dimethyl-4-oxohexanoate;hydrochloride |
|---|---|
| PubChem CID | 105481491 |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 2-amino-5,5-dimethyl-4-oxohexanoate;hydrochloride |
| SMILES | COC(=O)C(N)CC(=O)C(C)(C)C.Cl |
| InChI | InChI=1S/C9H17NO3.ClH/c1-9(2,3)7(11)5-6(10)8(12)13-4;/h6H,5,10H2,1-4H3;1H |
| InChIKey | WSWRECZYDRXHKL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |