methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate

C5H11NO3 — CID 170585123

IUPACmethyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate
SMILES[2H]C([2H])([2H])OC[C@H](N)C(=O)OC
InChIInChI=1S/C5H11NO3/c1-8-3-4(6)5(7)9-2/h4H,3,6H2,1-2H3/t4-/m0/s1/i1D3
InChIKeyYDZUJIKUFFJJBR-OSIBIXDNSA-N
MW136.17 g/mol
LogP-0.87
Rot. Bonds4

About methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate

methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate (PubChem CID 170585123) has the molecular formula C5H11NO3 and a molecular weight of 136.17 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate.

Molecular Properties

Compound Namemethyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate
PubChem CID170585123
Molecular FormulaC5H11NO3
Molecular Weight136.17 g/mol
Exact Mass136.09
IUPAC Namemethyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate
SMILES[2H]C([2H])([2H])OC[C@H](N)C(=O)OC
InChIInChI=1S/C5H11NO3/c1-8-3-4(6)5(7)9-2/h4H,3,6H2,1-2H3/t4-/m0/s1/i1D3
InChIKeyYDZUJIKUFFJJBR-OSIBIXDNSA-N
XLogP-0.87
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500136.17
LogP ≤ 5-0.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate?
The IUPAC name of methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate (CID 170585123) is methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate.
What is the SMILES notation for methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate?
The canonical SMILES for methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate is [2H]C([2H])([2H])OC[C@H](N)C(=O)OC.
What is the InChIKey of methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate?
The InChIKey is YDZUJIKUFFJJBR-OSIBIXDNSA-N. The full InChI is InChI=1S/C5H11NO3/c1-8-3-4(6)5(7)9-2/h4H,3,6H2,1-2H3/t4-/m0/s1/i1D3.
What are the key properties of methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate?
methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate has a molecular weight of 136.17 g/mol, XLogP of -0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-3-(trideuteriomethoxy)propanoate is sourced from PubChem (CID 170585123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).