C13H17NO8S — CID 142436501
(2S)-2-acetamido-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]butanoic acid (PubChem CID 142436501) has the molecular formula C13H17NO8S and a molecular weight of 347.35 g/mol. Its IUPAC name is (2S)-2-acetamido-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]butanoic acid.
| Compound Name | (2S)-2-acetamido-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 142436501 |
| Molecular Formula | C13H17NO8S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (2S)-2-acetamido-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]butanoic acid |
| SMILES | CC(=O)N[C@@H](C(=O)O)C(C)(C)SC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C13H17NO8S/c1-6-8(22-11(18)21-6)5-20-12(19)23-13(3,4)9(10(16)17)14-7(2)15/h9H,5H2,1-4H3,(H,14,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | KMJUZEVIPHPPQV-VIFPVBQESA-N |
| XLogP | 1.28 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|