C18H25NO10S — CID 142436546
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S)-2-acetamido-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate (PubChem CID 142436546) has the molecular formula C18H25NO10S and a molecular weight of 447.46 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S)-2-acetamido-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S)-2-acetamido-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate |
|---|---|
| PubChem CID | 142436546 |
| Molecular Formula | C18H25NO10S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (2S)-2-acetamido-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate |
| SMILES | CC(=O)N[C@@H](C(=O)OCc1oc(=O)oc1C)C(C)(C)SC(=O)OCOC(=O)C(C)C |
| InChI | InChI=1S/C18H25NO10S/c1-9(2)14(21)26-8-27-17(24)30-18(5,6)13(19-11(4)20)15(22)25-7-12-10(3)28-16(23)29-12/h9,13H,7-8H2,1-6H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | URDFZDFGGBONAZ-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 151.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|