C18H25NO11S — CID 142436429
methyl (2S)-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]-2-(2-methylpropanoyloxymethoxycarbonylamino)butanoate (PubChem CID 142436429) has the molecular formula C18H25NO11S and a molecular weight of 463.46 g/mol. Its IUPAC name is methyl (2S)-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]-2-(2-methylpropanoyloxymethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S)-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]-2-(2-methylpropanoyloxymethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 142436429 |
| Molecular Formula | C18H25NO11S |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | methyl (2S)-3-methyl-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]-2-(2-methylpropanoyloxymethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@H](NC(=O)OCOC(=O)C(C)C)C(C)(C)SC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C18H25NO11S/c1-9(2)13(20)27-8-28-15(22)19-12(14(21)25-6)18(4,5)31-17(24)26-7-11-10(3)29-16(23)30-11/h9,12H,7-8H2,1-6H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | SYEFXCFTYIBOKT-LBPRGKRZSA-N |
| XLogP | 2.11 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|