C12H17NO9S — CID 142436120
2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]ethylcarbamoyloxymethyl acetate;molecular hydrogen (PubChem CID 142436120) has the molecular formula C12H17NO9S and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]ethylcarbamoyloxymethyl acetate;molecular hydrogen.
| Compound Name | 2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]ethylcarbamoyloxymethyl acetate;molecular hydrogen |
|---|---|
| PubChem CID | 142436120 |
| Molecular Formula | C12H17NO9S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]ethylcarbamoyloxymethyl acetate;molecular hydrogen |
| SMILES | CC(=O)OCOC(=O)NCCSC(=O)OCc1oc(=O)oc1C.[H][H] |
| InChI | InChI=1S/C12H15NO9S.H2/c1-7-9(22-11(16)21-7)5-18-12(17)23-4-3-13-10(15)20-6-19-8(2)14;/h3-6H2,1-2H3,(H,13,15);1H |
| InChIKey | FHTMEOFCQVCEAZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|