C7H7BrO5 — CID 170649836
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-bromoacetate (PubChem CID 170649836) has the molecular formula C7H7BrO5 and a molecular weight of 251.03 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-bromoacetate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-bromoacetate |
|---|---|
| PubChem CID | 170649836 |
| Molecular Formula | C7H7BrO5 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.95 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-bromoacetate |
| SMILES | Cc1oc(=O)oc1COC(=O)CBr |
| InChI | InChI=1S/C7H7BrO5/c1-4-5(13-7(10)12-4)3-11-6(9)2-8/h2-3H2,1H3 |
| InChIKey | LNIQJWMZPZMXFW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|