C8H12ClNO5S — CID 129046033
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-aminoethylsulfanylformate;hydrochloride (PubChem CID 129046033) has the molecular formula C8H12ClNO5S and a molecular weight of 269.71 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-aminoethylsulfanylformate;hydrochloride.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-aminoethylsulfanylformate;hydrochloride |
|---|---|
| PubChem CID | 129046033 |
| Molecular Formula | C8H12ClNO5S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-aminoethylsulfanylformate;hydrochloride |
| SMILES | Cc1oc(=O)oc1COC(=O)SCCN.Cl |
| InChI | InChI=1S/C8H11NO5S.ClH/c1-5-6(14-7(10)13-5)4-12-8(11)15-3-2-9;/h2-4,9H2,1H3;1H |
| InChIKey | KWABFTVSDDZVEQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|