C8H9ClO4 — CID 118882291
4-(1-chloroprop-1-enoxymethyl)-5-methyl-1,3-dioxol-2-one (PubChem CID 118882291) has the molecular formula C8H9ClO4 and a molecular weight of 204.61 g/mol. Its IUPAC name is 4-(1-chloroprop-1-enoxymethyl)-5-methyl-1,3-dioxol-2-one.
| Compound Name | 4-(1-chloroprop-1-enoxymethyl)-5-methyl-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 118882291 |
| Molecular Formula | C8H9ClO4 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 4-(1-chloroprop-1-enoxymethyl)-5-methyl-1,3-dioxol-2-one |
| SMILES | CC=C(Cl)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C8H9ClO4/c1-3-7(9)11-4-6-5(2)12-8(10)13-6/h3H,4H2,1-2H3 |
| InChIKey | WJPVZWGEUWHGBG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|