C9H14O4 — CID 154678106
ethene;4-(ethoxymethyl)-5-methyl-1,3-dioxol-2-one (PubChem CID 154678106) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is ethene;4-(ethoxymethyl)-5-methyl-1,3-dioxol-2-one.
| Compound Name | ethene;4-(ethoxymethyl)-5-methyl-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 154678106 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | ethene;4-(ethoxymethyl)-5-methyl-1,3-dioxol-2-one |
| SMILES | C=C.CCOCc1oc(=O)oc1C |
| InChI | InChI=1S/C7H10O4.C2H4/c1-3-9-4-6-5(2)10-7(8)11-6;1-2/h3-4H2,1-2H3;1-2H2 |
| InChIKey | NFZRKTRDUPPEDL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|