C14H16O8 — CID 138517728
4-methyl-5-[[(E)-4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]but-2-enoxy]methyl]-1,3-dioxol-2-one (PubChem CID 138517728) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is 4-methyl-5-[[(E)-4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]but-2-enoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-methyl-5-[[(E)-4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]but-2-enoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 138517728 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-methyl-5-[[(E)-4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]but-2-enoxy]methyl]-1,3-dioxol-2-one |
| SMILES | Cc1oc(=O)oc1COC/C=C/COCc1oc(=O)oc1C |
| InChI | InChI=1S/C14H16O8/c1-9-11(21-13(15)19-9)7-17-5-3-4-6-18-8-12-10(2)20-14(16)22-12/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | JUHYQMKXEJPTJR-ONEGZZNKSA-N |
| XLogP | 1.69 |
| TPSA | 105.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|