C10H14O5 — CID 59107308
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pentanoate (PubChem CID 59107308) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pentanoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pentanoate |
|---|---|
| PubChem CID | 59107308 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pentanoate |
| SMILES | CCCCC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C10H14O5/c1-3-4-5-9(11)13-6-8-7(2)14-10(12)15-8/h3-6H2,1-2H3 |
| InChIKey | QIGYRNHSYYJSTD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |