C18H30O5 — CID 166842545
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-pentyloctanoate (PubChem CID 166842545) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-pentyloctanoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-pentyloctanoate |
|---|---|
| PubChem CID | 166842545 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-pentyloctanoate |
| SMILES | CCCCCCC(CCCCC)C(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C18H30O5/c1-4-6-8-10-12-15(11-9-7-5-2)17(19)21-13-16-14(3)22-18(20)23-16/h15H,4-13H2,1-3H3 |
| InChIKey | UMWDRAQCLCYGCO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|