C12H18N2O10 — CID 89081502
[2-amino-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-3-oxopropyl] 4-(dihydroxyamino)oxybutanoate (PubChem CID 89081502) has the molecular formula C12H18N2O10 and a molecular weight of 350.28 g/mol. Its IUPAC name is [2-amino-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-3-oxopropyl] 4-(dihydroxyamino)oxybutanoate.
| Compound Name | [2-amino-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-3-oxopropyl] 4-(dihydroxyamino)oxybutanoate |
|---|---|
| PubChem CID | 89081502 |
| Molecular Formula | C12H18N2O10 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [2-amino-3-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-3-oxopropyl] 4-(dihydroxyamino)oxybutanoate |
| SMILES | Cc1oc(=O)oc1COC(=O)C(N)COC(=O)CCCON(O)O |
| InChI | InChI=1S/C12H18N2O10/c1-7-9(24-12(17)23-7)6-21-11(16)8(13)5-20-10(15)3-2-4-22-14(18)19/h8,18-19H,2-6,13H2,1H3 |
| InChIKey | NCGSFRXWTIVCJG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 174.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|