C11H14ClNO6 — CID 155596941
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(4-chloro-4-oxobutyl)-N-methylcarbamate (PubChem CID 155596941) has the molecular formula C11H14ClNO6 and a molecular weight of 291.69 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(4-chloro-4-oxobutyl)-N-methylcarbamate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(4-chloro-4-oxobutyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 155596941 |
| Molecular Formula | C11H14ClNO6 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(4-chloro-4-oxobutyl)-N-methylcarbamate |
| SMILES | Cc1oc(=O)oc1COC(=O)N(C)CCCC(=O)Cl |
| InChI | InChI=1S/C11H14ClNO6/c1-7-8(19-11(16)18-7)6-17-10(15)13(2)5-3-4-9(12)14/h3-6H2,1-2H3 |
| InChIKey | SFPPXIMTFJSCOQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|