C11H15O10P — CID 118896154
5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid (PubChem CID 118896154) has the molecular formula C11H15O10P and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid.
| Compound Name | 5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid |
|---|---|
| PubChem CID | 118896154 |
| Molecular Formula | C11H15O10P |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid |
| SMILES | Cc1oc(=O)oc1COC(=O)CCC(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C11H15O10P/c1-6-8(21-11(15)20-6)4-19-9(12)3-2-7(10(13)14)5-22(16,17)18/h7H,2-5H2,1H3,(H,13,14)(H2,16,17,18) |
| InChIKey | UBZVFNHCONXXRH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|