C13H21NO7S — CID 142436134
ethyl (2S)-2-acetamido-3-(acetyloxymethoxycarbonylsulfanyl)-3-methylbutanoate (PubChem CID 142436134) has the molecular formula C13H21NO7S and a molecular weight of 335.38 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-3-(acetyloxymethoxycarbonylsulfanyl)-3-methylbutanoate.
| Compound Name | ethyl (2S)-2-acetamido-3-(acetyloxymethoxycarbonylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 142436134 |
| Molecular Formula | C13H21NO7S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | ethyl (2S)-2-acetamido-3-(acetyloxymethoxycarbonylsulfanyl)-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](NC(C)=O)C(C)(C)SC(=O)OCOC(C)=O |
| InChI | InChI=1S/C13H21NO7S/c1-6-19-11(17)10(14-8(2)15)13(4,5)22-12(18)21-7-20-9(3)16/h10H,6-7H2,1-5H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | OWMPHNLBFFPCFM-JTQLQIEISA-N |
| XLogP | 1.22 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|