C16H27NO7S — CID 145289259
ethyl 3-(4-methoxy-3,4-dioxobutanoyl)sulfanyl-3-methyl-2-(2-methylpropanoylamino)butanoate;molecular hydrogen (PubChem CID 145289259) has the molecular formula C16H27NO7S and a molecular weight of 377.46 g/mol. Its IUPAC name is ethyl 3-(4-methoxy-3,4-dioxobutanoyl)sulfanyl-3-methyl-2-(2-methylpropanoylamino)butanoate;molecular hydrogen.
| Compound Name | ethyl 3-(4-methoxy-3,4-dioxobutanoyl)sulfanyl-3-methyl-2-(2-methylpropanoylamino)butanoate;molecular hydrogen |
|---|---|
| PubChem CID | 145289259 |
| Molecular Formula | C16H27NO7S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 3-(4-methoxy-3,4-dioxobutanoyl)sulfanyl-3-methyl-2-(2-methylpropanoylamino)butanoate;molecular hydrogen |
| SMILES | CCOC(=O)C(NC(=O)C(C)C)C(C)(C)SC(=O)CC(=O)C(=O)OC.[H][H] |
| InChI | InChI=1S/C16H25NO7S.H2/c1-7-24-15(22)12(17-13(20)9(2)3)16(4,5)25-11(19)8-10(18)14(21)23-6;/h9,12H,7-8H2,1-6H3,(H,17,20);1H |
| InChIKey | WMKRXTMHWPEABQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|