C17H29NO6S — CID 129026159
ethyl 3-(3-ethoxy-3-oxopropanoyl)sulfanyl-3-methyl-2-(2-methylbutanoylamino)butanoate (PubChem CID 129026159) has the molecular formula C17H29NO6S and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 3-(3-ethoxy-3-oxopropanoyl)sulfanyl-3-methyl-2-(2-methylbutanoylamino)butanoate.
| Compound Name | ethyl 3-(3-ethoxy-3-oxopropanoyl)sulfanyl-3-methyl-2-(2-methylbutanoylamino)butanoate |
|---|---|
| PubChem CID | 129026159 |
| Molecular Formula | C17H29NO6S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl 3-(3-ethoxy-3-oxopropanoyl)sulfanyl-3-methyl-2-(2-methylbutanoylamino)butanoate |
| SMILES | CCOC(=O)CC(=O)SC(C)(C)C(NC(=O)C(C)CC)C(=O)OCC |
| InChI | InChI=1S/C17H29NO6S/c1-7-11(4)15(21)18-14(16(22)24-9-3)17(5,6)25-13(20)10-12(19)23-8-2/h11,14H,7-10H2,1-6H3,(H,18,21) |
| InChIKey | FELFOCSHFUKTRZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|