C19H32N2O6S — CID 129026043
ethyl 4-[4-(diethylamino)-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-3,4-dioxobutanoate (PubChem CID 129026043) has the molecular formula C19H32N2O6S and a molecular weight of 416.54 g/mol. Its IUPAC name is ethyl 4-[4-(diethylamino)-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-3,4-dioxobutanoate.
| Compound Name | ethyl 4-[4-(diethylamino)-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 129026043 |
| Molecular Formula | C19H32N2O6S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl 4-[4-(diethylamino)-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-3,4-dioxobutanoate |
| SMILES | CCOC(=O)CC(=O)C(=O)SC(C)C(NC(=O)C(C)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C19H32N2O6S/c1-7-12(5)17(24)20-16(18(25)21(8-2)9-3)13(6)28-19(26)14(22)11-15(23)27-10-4/h12-13,16H,7-11H2,1-6H3,(H,20,24) |
| InChIKey | OGQOADINMMNACB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|