C21H36N2O6S — CID 129026034
propan-2-yl 4-[4-(diethylamino)-2-methyl-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-2,4-dioxobutanoate (PubChem CID 129026034) has the molecular formula C21H36N2O6S and a molecular weight of 444.59 g/mol. Its IUPAC name is propan-2-yl 4-[4-(diethylamino)-2-methyl-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-2,4-dioxobutanoate.
| Compound Name | propan-2-yl 4-[4-(diethylamino)-2-methyl-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 129026034 |
| Molecular Formula | C21H36N2O6S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | propan-2-yl 4-[4-(diethylamino)-2-methyl-3-(2-methylbutanoylamino)-4-oxobutan-2-yl]sulfanyl-2,4-dioxobutanoate |
| SMILES | CCC(C)C(=O)NC(C(=O)N(CC)CC)C(C)(C)SC(=O)CC(=O)C(=O)OC(C)C |
| InChI | InChI=1S/C21H36N2O6S/c1-9-14(6)18(26)22-17(19(27)23(10-2)11-3)21(7,8)30-16(25)12-15(24)20(28)29-13(4)5/h13-14,17H,9-12H2,1-8H3,(H,22,26) |
| InChIKey | NORROXVMACELMV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|