C17H28N2O6S — CID 129026057
propan-2-yl 4-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl]sulfanyl-3,4-dioxobutanoate (PubChem CID 129026057) has the molecular formula C17H28N2O6S and a molecular weight of 388.49 g/mol. Its IUPAC name is propan-2-yl 4-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl]sulfanyl-3,4-dioxobutanoate.
| Compound Name | propan-2-yl 4-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl]sulfanyl-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 129026057 |
| Molecular Formula | C17H28N2O6S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | propan-2-yl 4-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl]sulfanyl-3,4-dioxobutanoate |
| SMILES | CCC(=O)NC(CSC(=O)C(=O)CC(=O)OC(C)C)C(=O)N(CC)CC |
| InChI | InChI=1S/C17H28N2O6S/c1-6-14(21)18-12(16(23)19(7-2)8-3)10-26-17(24)13(20)9-15(22)25-11(4)5/h11-12H,6-10H2,1-5H3,(H,18,21) |
| InChIKey | WEUNCDQHJZBETO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|