C24H44N4O6S2 — CID 123228828
1-S-[3-(diethylamino)-3-hydroxy-2-(propanoylamino)propyl] 4-S-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl] butanebis(thioate) (PubChem CID 123228828) has the molecular formula C24H44N4O6S2 and a molecular weight of 548.77 g/mol. Its IUPAC name is 1-S-[3-(diethylamino)-3-hydroxy-2-(propanoylamino)propyl] 4-S-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl] butanebis(thioate).
| Compound Name | 1-S-[3-(diethylamino)-3-hydroxy-2-(propanoylamino)propyl] 4-S-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl] butanebis(thioate) |
|---|---|
| PubChem CID | 123228828 |
| Molecular Formula | C24H44N4O6S2 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 1-S-[3-(diethylamino)-3-hydroxy-2-(propanoylamino)propyl] 4-S-[3-(diethylamino)-3-oxo-2-(propanoylamino)propyl] butanebis(thioate) |
| SMILES | CCC(=O)NC(CSC(=O)CCC(=O)SCC(NC(=O)CC)C(O)N(CC)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C24H44N4O6S2/c1-7-19(29)25-17(23(33)27(9-3)10-4)15-35-21(31)13-14-22(32)36-16-18(26-20(30)8-2)24(34)28(11-5)12-6/h17-18,23,33H,7-16H2,1-6H3,(H,25,29)(H,26,30) |
| InChIKey | VKEFRQQIWZDAPG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|