C15H23NO7S — CID 145289262
ethyl 4-[3-ethoxy-2-(2-methylpropanoylamino)-3-oxopropyl]sulfanyl-3,4-dioxobutanoate (PubChem CID 145289262) has the molecular formula C15H23NO7S and a molecular weight of 361.42 g/mol. Its IUPAC name is ethyl 4-[3-ethoxy-2-(2-methylpropanoylamino)-3-oxopropyl]sulfanyl-3,4-dioxobutanoate.
| Compound Name | ethyl 4-[3-ethoxy-2-(2-methylpropanoylamino)-3-oxopropyl]sulfanyl-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 145289262 |
| Molecular Formula | C15H23NO7S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | ethyl 4-[3-ethoxy-2-(2-methylpropanoylamino)-3-oxopropyl]sulfanyl-3,4-dioxobutanoate |
| SMILES | CCOC(=O)CC(=O)C(=O)SCC(NC(=O)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H23NO7S/c1-5-22-12(18)7-11(17)15(21)24-8-10(14(20)23-6-2)16-13(19)9(3)4/h9-10H,5-8H2,1-4H3,(H,16,19) |
| InChIKey | KXBCROWGTBSWKF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|