C15H28N2O4S — CID 118527149
propan-2-yl (2R)-3-[(2S)-2-amino-3-methylbutanoyl]sulfanyl-2-(2-methylpropanoylamino)propanoate (PubChem CID 118527149) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is propan-2-yl (2R)-3-[(2S)-2-amino-3-methylbutanoyl]sulfanyl-2-(2-methylpropanoylamino)propanoate.
| Compound Name | propan-2-yl (2R)-3-[(2S)-2-amino-3-methylbutanoyl]sulfanyl-2-(2-methylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 118527149 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | propan-2-yl (2R)-3-[(2S)-2-amino-3-methylbutanoyl]sulfanyl-2-(2-methylpropanoylamino)propanoate |
| SMILES | CC(C)OC(=O)[C@H](CSC(=O)[C@@H](N)C(C)C)NC(=O)C(C)C |
| InChI | InChI=1S/C15H28N2O4S/c1-8(2)12(16)15(20)22-7-11(14(19)21-10(5)6)17-13(18)9(3)4/h8-12H,7,16H2,1-6H3,(H,17,18)/t11-,12-/m0/s1 |
| InChIKey | ZQEJRHLVKURJOD-RYUDHWBXSA-N |
| XLogP | 1.32 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|