About propan-2-yl ethylsulfanylformate
propan-2-yl ethylsulfanylformate (PubChem CID 130241009) has the molecular formula C6H12O2S
and a molecular weight of 148.23 g/mol. Its IUPAC name is propan-2-yl ethylsulfanylformate.
Molecular Properties
| Compound Name | propan-2-yl ethylsulfanylformate |
| PubChem CID | 130241009 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | propan-2-yl ethylsulfanylformate |
| SMILES | CCSC(=O)OC(C)C |
| InChI | InChI=1S/C6H12O2S/c1-4-9-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| InChIKey | BYMBBRUJLZRLFV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl ethylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl ethylsulfanylformate?
The IUPAC name of propan-2-yl ethylsulfanylformate (CID 130241009) is propan-2-yl ethylsulfanylformate.
What is the SMILES notation for propan-2-yl ethylsulfanylformate?
The canonical SMILES for propan-2-yl ethylsulfanylformate is CCSC(=O)OC(C)C.
What is the InChIKey of propan-2-yl ethylsulfanylformate?
The InChIKey is BYMBBRUJLZRLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-4-9-6(7)8-5(2)3/h5H,4H2,1-3H3.
What are the key properties of propan-2-yl ethylsulfanylformate?
propan-2-yl ethylsulfanylformate has a molecular weight of 148.23 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl ethylsulfanylformate is sourced from PubChem (CID 130241009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).