C9H14N2O6S — CID 150435965
ethyl (2R)-3-acetylsulfanyl-2-[(2-nitroacetyl)amino]propanoate (PubChem CID 150435965) has the molecular formula C9H14N2O6S and a molecular weight of 278.29 g/mol. Its IUPAC name is ethyl (2R)-3-acetylsulfanyl-2-[(2-nitroacetyl)amino]propanoate.
| Compound Name | ethyl (2R)-3-acetylsulfanyl-2-[(2-nitroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 150435965 |
| Molecular Formula | C9H14N2O6S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | ethyl (2R)-3-acetylsulfanyl-2-[(2-nitroacetyl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](CSC(C)=O)NC(=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N2O6S/c1-3-17-9(14)7(5-18-6(2)12)10-8(13)4-11(15)16/h7H,3-5H2,1-2H3,(H,10,13)/t7-/m0/s1 |
| InChIKey | HKTKYPZCSJBZET-ZETCQYMHSA-N |
| XLogP | -0.41 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|