About ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate
ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate (PubChem CID 160770913) has the molecular formula C14H24O5S
and a molecular weight of 304.41 g/mol. Its IUPAC name is ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate |
| PubChem CID | 160770913 |
| Molecular Formula | C14H24O5S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.CCOC(=O)C(C)CSC(C)=O |
| InChI | InChI=1S/C8H14O3S.C6H10O2/c1-4-11-8(10)6(2)5-12-7(3)9;1-4-8-6(7)5(2)3/h6H,4-5H2,1-3H3;2,4H2,1,3H3 |
| InChIKey | RZHMVRIUNDEXKQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate?
The IUPAC name of ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate (CID 160770913) is ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate?
The canonical SMILES for ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.CCOC(=O)C(C)CSC(C)=O.
What is the InChIKey of ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate?
The InChIKey is RZHMVRIUNDEXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3S.C6H10O2/c1-4-11-8(10)6(2)5-12-7(3)9;1-4-8-6(7)5(2)3/h6H,4-5H2,1-3H3;2,4H2,1,3H3.
What are the key properties of ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate?
ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate has a molecular weight of 304.41 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetylsulfanyl-2-methylpropanoate;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 160770913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).