About ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate
ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate (PubChem CID 160705791) has the molecular formula C16H28O5S
and a molecular weight of 332.46 g/mol. Its IUPAC name is ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate |
| PubChem CID | 160705791 |
| Molecular Formula | C16H28O5S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC.CCOC(=O)C(CC)CSC(C)=O |
| InChI | InChI=1S/C9H16O3S.C7H12O2/c1-4-8(6-13-7(3)10)9(11)12-5-2;1-4-6(3)7(8)9-5-2/h8H,4-6H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | RRFBLPORLAXUTO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate?
The IUPAC name of ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate (CID 160705791) is ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate.
What is the SMILES notation for ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate?
The canonical SMILES for ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate is C=C(CC)C(=O)OCC.CCOC(=O)C(CC)CSC(C)=O.
What is the InChIKey of ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate?
The InChIKey is RRFBLPORLAXUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S.C7H12O2/c1-4-8(6-13-7(3)10)9(11)12-5-2;1-4-6(3)7(8)9-5-2/h8H,4-6H2,1-3H3;3-5H2,1-2H3.
What are the key properties of ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate?
ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate has a molecular weight of 332.46 g/mol, XLogP of 3.37, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(acetylsulfanylmethyl)butanoate;ethyl 2-methylidenebutanoate is sourced from PubChem (CID 160705791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).