About ethyl heptanoate;ethyl 2-methylbutanoate
ethyl heptanoate;ethyl 2-methylbutanoate (PubChem CID 155167071) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is ethyl heptanoate;ethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | ethyl heptanoate;ethyl 2-methylbutanoate |
| PubChem CID | 155167071 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | ethyl heptanoate;ethyl 2-methylbutanoate |
| SMILES | CCCCCCC(=O)OCC.CCOC(=O)C(C)CC |
| InChI | InChI=1S/C9H18O2.C7H14O2/c1-3-5-6-7-8-9(10)11-4-2;1-4-6(3)7(8)9-5-2/h3-8H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | VIUADLXRCBLLEL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl heptanoate;ethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl heptanoate;ethyl 2-methylbutanoate?
The IUPAC name of ethyl heptanoate;ethyl 2-methylbutanoate (CID 155167071) is ethyl heptanoate;ethyl 2-methylbutanoate.
What is the SMILES notation for ethyl heptanoate;ethyl 2-methylbutanoate?
The canonical SMILES for ethyl heptanoate;ethyl 2-methylbutanoate is CCCCCCC(=O)OCC.CCOC(=O)C(C)CC.
What is the InChIKey of ethyl heptanoate;ethyl 2-methylbutanoate?
The InChIKey is VIUADLXRCBLLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C7H14O2/c1-3-5-6-7-8-9(10)11-4-2;1-4-6(3)7(8)9-5-2/h3-8H2,1-2H3;6H,4-5H2,1-3H3.
What are the key properties of ethyl heptanoate;ethyl 2-methylbutanoate?
ethyl heptanoate;ethyl 2-methylbutanoate has a molecular weight of 288.43 g/mol, XLogP of 4.12, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl heptanoate;ethyl 2-methylbutanoate is sourced from PubChem (CID 155167071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).