C12H19NO7S — CID 129066230
2-acetamido-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoic acid (PubChem CID 129066230) has the molecular formula C12H19NO7S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-acetamido-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoic acid.
| Compound Name | 2-acetamido-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 129066230 |
| Molecular Formula | C12H19NO7S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-acetamido-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoic acid |
| SMILES | CCC(=O)OCOC(=O)SC(C)(C)C(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C12H19NO7S/c1-5-8(15)19-6-20-11(18)21-12(3,4)9(10(16)17)13-7(2)14/h9H,5-6H2,1-4H3,(H,13,14)(H,16,17) |
| InChIKey | VJRQFRDJHGHYCA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|