C21H31N3O13S — CID 57253619
[(2R,3R,4S,5R)-6-[[(2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoyl]amino]-3,4,5-triacetyloxy-1-hydroxy-6-oxohexan-2-yl] acetate (PubChem CID 57253619) has the molecular formula C21H31N3O13S and a molecular weight of 565.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-[[(2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoyl]amino]-3,4,5-triacetyloxy-1-hydroxy-6-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-6-[[(2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoyl]amino]-3,4,5-triacetyloxy-1-hydroxy-6-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 57253619 |
| Molecular Formula | C21H31N3O13S |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | [(2R,3R,4S,5R)-6-[[(2R)-2-acetamido-3-methyl-3-nitrososulfanylbutanoyl]amino]-3,4,5-triacetyloxy-1-hydroxy-6-oxohexan-2-yl] acetate |
| SMILES | CC(=O)N[C@H](C(=O)NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CO)OC(C)=O)C(C)(C)SN=O |
| InChI | InChI=1S/C21H31N3O13S/c1-9(26)22-18(21(6,7)38-24-33)20(32)23-19(31)17(37-13(5)30)16(36-12(4)29)15(35-11(3)28)14(8-25)34-10(2)27/h14-18,25H,8H2,1-7H3,(H,22,26)(H,23,31,32)/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | QBSFZZJFQGYGET-UYTYNIKBSA-N |
| XLogP | -0.95 |
| TPSA | 230.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|