C13H20N2O8 — CID 102499783
[(2R,4R)-2,4-diacetyloxy-1,5-bis(methylamino)-1,5-dioxopentan-3-yl] acetate (PubChem CID 102499783) has the molecular formula C13H20N2O8 and a molecular weight of 332.31 g/mol. Its IUPAC name is [(2R,4R)-2,4-diacetyloxy-1,5-bis(methylamino)-1,5-dioxopentan-3-yl] acetate.
| Compound Name | [(2R,4R)-2,4-diacetyloxy-1,5-bis(methylamino)-1,5-dioxopentan-3-yl] acetate |
|---|---|
| PubChem CID | 102499783 |
| Molecular Formula | C13H20N2O8 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(2R,4R)-2,4-diacetyloxy-1,5-bis(methylamino)-1,5-dioxopentan-3-yl] acetate |
| SMILES | CNC(=O)[C@H](OC(C)=O)C(OC(C)=O)[C@@H](OC(C)=O)C(=O)NC |
| InChI | InChI=1S/C13H20N2O8/c1-6(16)21-9(10(12(19)14-4)22-7(2)17)11(13(20)15-5)23-8(3)18/h9-11H,1-5H3,(H,14,19)(H,15,20)/t10-,11-/m1/s1 |
| InChIKey | VQVLKCIZWXDLQV-GHMZBOCLSA-N |
| XLogP | -1.73 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|