C14H22N2O8 — CID 4863600
[2,5-diacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate (PubChem CID 4863600) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2,5-diacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [2,5-diacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 4863600 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [2,5-diacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate |
| SMILES | CNC(=O)C(CC(OC(C)=O)C(OC(C)=O)C(=O)NC)OC(C)=O |
| InChI | InChI=1S/C14H22N2O8/c1-7(17)22-10(12(14(21)16-5)24-9(3)19)6-11(13(20)15-4)23-8(2)18/h10-12H,6H2,1-5H3,(H,15,20)(H,16,21) |
| InChIKey | RRCGIUPXSVFSKC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|